C19H20N8O2S — CID 17383508
8-[[5-(anilinomethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-1,3-dimethyl-7H-purine-2,6-dione (PubChem CID 17383508) has the molecular formula C19H20N8O2S and a molecular weight of 424.49 g/mol. Its IUPAC name is 8-[[5-(anilinomethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-1,3-dimethyl-7H-purine-2,6-dione.
| Compound Name | 8-[[5-(anilinomethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-1,3-dimethyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 17383508 |
| Molecular Formula | C19H20N8O2S |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 8-[[5-(anilinomethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-1,3-dimethyl-7H-purine-2,6-dione |
| SMILES | C=CCn1c(CNc2ccccc2)nnc1Sc1nc2c([nH]1)c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C19H20N8O2S/c1-4-10-27-13(11-20-12-8-6-5-7-9-12)23-24-18(27)30-17-21-14-15(22-17)25(2)19(29)26(3)16(14)28/h4-9,20H,1,10-11H2,2-3H3,(H,21,22) |
| InChIKey | YVMBQLMCPPZMSR-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 115.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|