C17H19BO4 — CID 174004081
ethyl 8-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)naphthalene-1-carboxylate (PubChem CID 174004081) has the molecular formula C17H19BO4 and a molecular weight of 298.15 g/mol. Its IUPAC name is ethyl 8-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)naphthalene-1-carboxylate.
| Compound Name | ethyl 8-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 174004081 |
| Molecular Formula | C17H19BO4 |
| Molecular Weight | 298.15 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | ethyl 8-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)naphthalene-1-carboxylate |
| SMILES | CCOC(=O)c1cccc2cccc(B3OCC(C)(C)O3)c12 |
| InChI | InChI=1S/C17H19BO4/c1-4-20-16(19)13-9-5-7-12-8-6-10-14(15(12)13)18-21-11-17(2,3)22-18/h5-10H,4,11H2,1-3H3 |
| InChIKey | YZCWNVJMCZWHRW-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.15 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|