C12H22F3NOS — CID 174004821
tert-butyl-oxido-[[(4R)-1,1,1-trifluorooct-7-en-4-yl]amino]sulfanium (PubChem CID 174004821) has the molecular formula C12H22F3NOS and a molecular weight of 285.38 g/mol. Its IUPAC name is tert-butyl-oxido-[[(4R)-1,1,1-trifluorooct-7-en-4-yl]amino]sulfanium.
| Compound Name | tert-butyl-oxido-[[(4R)-1,1,1-trifluorooct-7-en-4-yl]amino]sulfanium |
|---|---|
| PubChem CID | 174004821 |
| Molecular Formula | C12H22F3NOS |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | tert-butyl-oxido-[[(4R)-1,1,1-trifluorooct-7-en-4-yl]amino]sulfanium |
| SMILES | C=CCC[C@H](CCC(F)(F)F)N[S+]([O-])C(C)(C)C |
| InChI | InChI=1S/C12H22F3NOS/c1-5-6-7-10(8-9-12(13,14)15)16-18(17)11(2,3)4/h5,10,16H,1,6-9H2,2-4H3/t10-,18?/m1/s1 |
| InChIKey | APDMBODLSWCUOD-DMPGVRBJSA-N |
| XLogP | 3.72 |
| TPSA | 35.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|