C18H26F3NO4SSi — CID 174005070
2,2,2-trifluoroethyl 3-[2-methoxy-N-methyl-5-(2-trimethylsilylethynyl)anilino]propane-1-sulfonate (PubChem CID 174005070) has the molecular formula C18H26F3NO4SSi and a molecular weight of 437.56 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 3-[2-methoxy-N-methyl-5-(2-trimethylsilylethynyl)anilino]propane-1-sulfonate.
| Compound Name | 2,2,2-trifluoroethyl 3-[2-methoxy-N-methyl-5-(2-trimethylsilylethynyl)anilino]propane-1-sulfonate |
|---|---|
| PubChem CID | 174005070 |
| Molecular Formula | C18H26F3NO4SSi |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | 2,2,2-trifluoroethyl 3-[2-methoxy-N-methyl-5-(2-trimethylsilylethynyl)anilino]propane-1-sulfonate |
| SMILES | COc1ccc(C#C[Si](C)(C)C)cc1N(C)CCCS(=O)(=O)OCC(F)(F)F |
| InChI | InChI=1S/C18H26F3NO4SSi/c1-22(10-6-11-27(23,24)26-14-18(19,20)21)16-13-15(7-8-17(16)25-2)9-12-28(3,4)5/h7-8,13H,6,10-11,14H2,1-5H3 |
| InChIKey | ZKMGTRRLZGOYAV-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|