C14H20F3NO2S — CID 167044977
2-methoxy-N,5-dimethyl-N-[3-(2,2,2-trifluoroethoxysulfanyl)propyl]aniline (PubChem CID 167044977) has the molecular formula C14H20F3NO2S and a molecular weight of 323.38 g/mol. Its IUPAC name is 2-methoxy-N,5-dimethyl-N-[3-(2,2,2-trifluoroethoxysulfanyl)propyl]aniline.
| Compound Name | 2-methoxy-N,5-dimethyl-N-[3-(2,2,2-trifluoroethoxysulfanyl)propyl]aniline |
|---|---|
| PubChem CID | 167044977 |
| Molecular Formula | C14H20F3NO2S |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 2-methoxy-N,5-dimethyl-N-[3-(2,2,2-trifluoroethoxysulfanyl)propyl]aniline |
| SMILES | COc1ccc(C)cc1N(C)CCCSOCC(F)(F)F |
| InChI | InChI=1S/C14H20F3NO2S/c1-11-5-6-13(19-3)12(9-11)18(2)7-4-8-21-20-10-14(15,16)17/h5-6,9H,4,7-8,10H2,1-3H3 |
| InChIKey | SYQKWEUXASQUFD-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|