C18H12BNO — CID 174007713
8-oxa-20-aza-1-borapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-2,4,6,9,11,13(21),14,16,18-nonaene (PubChem CID 174007713) has the molecular formula C18H12BNO and a molecular weight of 269.11 g/mol. Its IUPAC name is 8-oxa-20-aza-1-borapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-2,4,6,9,11,13(21),14,16,18-nonaene.
| Compound Name | 8-oxa-20-aza-1-borapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-2,4,6,9,11,13(21),14,16,18-nonaene |
|---|---|
| PubChem CID | 174007713 |
| Molecular Formula | C18H12BNO |
| Molecular Weight | 269.11 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 8-oxa-20-aza-1-borapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-2,4,6,9,11,13(21),14,16,18-nonaene |
| SMILES | c1ccc2c(c1)NB1c3ccccc3Oc3cccc-2c31 |
| InChI | InChI=1S/C18H12BNO/c1-3-9-15-12(6-1)13-7-5-11-17-18(13)19(20-15)14-8-2-4-10-16(14)21-17/h1-11,20H |
| InChIKey | LUBOHSXIRLEPDO-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.11 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|