C12H8BBrO — CID 91401182
10-bromobenzo[b][1,4]benzoxaborinine (PubChem CID 91401182) has the molecular formula C12H8BBrO and a molecular weight of 258.91 g/mol. Its IUPAC name is 10-bromobenzo[b][1,4]benzoxaborinine.
| Compound Name | 10-bromobenzo[b][1,4]benzoxaborinine |
|---|---|
| PubChem CID | 91401182 |
| Molecular Formula | C12H8BBrO |
| Molecular Weight | 258.91 g/mol |
| Exact Mass | 257.99 |
| IUPAC Name | 10-bromobenzo[b][1,4]benzoxaborinine |
| SMILES | BrB1c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C12H8BBrO/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8H |
| InChIKey | AWIPZVIRESETDT-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.91 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|