C18H13O2+ — CID 163695245
5-phenyldibenzo-p-dioxin-5-ium (PubChem CID 163695245) has the molecular formula C18H13O2+ and a molecular weight of 261.30 g/mol. Its IUPAC name is 5-phenyldibenzo-p-dioxin-5-ium.
| Compound Name | 5-phenyldibenzo-p-dioxin-5-ium |
|---|---|
| PubChem CID | 163695245 |
| Molecular Formula | C18H13O2+ |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 5-phenyldibenzo-p-dioxin-5-ium |
| SMILES | c1ccc([O+]2c3ccccc3Oc3ccccc32)cc1 |
| InChI | InChI=1S/C18H13O2/c1-2-8-14(9-3-1)20-17-12-6-4-10-15(17)19-16-11-5-7-13-18(16)20/h1-13H/q+1 |
| InChIKey | JWKNCTJBJYUNDG-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 11.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|