C13H25ClN2 — CID 174010390
1-[(E,5R)-2-chloro-4,5-dimethylhept-2-en-4-yl]piperazine (PubChem CID 174010390) has the molecular formula C13H25ClN2 and a molecular weight of 244.81 g/mol. Its IUPAC name is 1-[(E,5R)-2-chloro-4,5-dimethylhept-2-en-4-yl]piperazine.
| Compound Name | 1-[(E,5R)-2-chloro-4,5-dimethylhept-2-en-4-yl]piperazine |
|---|---|
| PubChem CID | 174010390 |
| Molecular Formula | C13H25ClN2 |
| Molecular Weight | 244.81 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 1-[(E,5R)-2-chloro-4,5-dimethylhept-2-en-4-yl]piperazine |
| SMILES | CC[C@@H](C)C(C)(/C=C(\C)Cl)N1CCNCC1 |
| InChI | InChI=1S/C13H25ClN2/c1-5-11(2)13(4,10-12(3)14)16-8-6-15-7-9-16/h10-11,15H,5-9H2,1-4H3/b12-10+/t11-,13?/m1/s1 |
| InChIKey | UPZGMNDZSDCPDA-NRGRDJQDSA-N |
| XLogP | 2.84 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.81 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |