C11H21BNO7P — CID 174012603
CID 174012603 (PubChem CID 174012603) has the molecular formula C11H21BNO7P and a molecular weight of 321.08 g/mol.
| Compound Name | CID 174012603 |
|---|---|
| PubChem CID | 174012603 |
| Molecular Formula | C11H21BNO7P |
| Molecular Weight | 321.08 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1O[C@H](/C=C/P(=O)(O)O)C(O)C1OCCOCCNC |
| InChI | InChI=1S/C11H21BNO7P/c1-13-3-4-18-5-6-19-10-9(14)8(20-11(10)12)2-7-21(15,16)17/h2,7-11,13-14H,3-6H2,1H3,(H2,15,16,17)/b7-2+/t8-,9?,10?,11-/m1/s1 |
| InChIKey | JLQDSMNBVVHXOH-KREUCTCXSA-N |
| XLogP | -1.45 |
| TPSA | 117.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.08 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|