C14H17FN2O2 — CID 174013193
methyl 3-[C-(2-aminoethenyl)-N-propylcarbonimidoyl]-5-fluorobenzoate (PubChem CID 174013193) has the molecular formula C14H17FN2O2 and a molecular weight of 264.30 g/mol. Its IUPAC name is methyl 3-[C-(2-aminoethenyl)-N-propylcarbonimidoyl]-5-fluorobenzoate.
| Compound Name | methyl 3-[C-(2-aminoethenyl)-N-propylcarbonimidoyl]-5-fluorobenzoate |
|---|---|
| PubChem CID | 174013193 |
| Molecular Formula | C14H17FN2O2 |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | methyl 3-[C-(2-aminoethenyl)-N-propylcarbonimidoyl]-5-fluorobenzoate |
| SMILES | CCC/N=C(\C=CN)c1cc(F)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C14H17FN2O2/c1-3-6-17-13(4-5-16)10-7-11(14(18)19-2)9-12(15)8-10/h4-5,7-9H,3,6,16H2,1-2H3/b5-4?,17-13+ |
| InChIKey | HWPIFLJMVUPRII-ANPNFZBWSA-N |
| XLogP | 2.28 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|