C25H23BNO3S — CID 174013972
CID 174013972 (PubChem CID 174013972) has the molecular formula C25H23BNO3S and a molecular weight of 428.34 g/mol.
| Compound Name | CID 174013972 |
|---|---|
| PubChem CID | 174013972 |
| Molecular Formula | C25H23BNO3S |
| Molecular Weight | 428.34 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | — |
| SMILES | CC(C)(O)C(C)(C)O[B]c1cccc2oc3cc4nc(-c5ccccc5)sc4cc3c12 |
| InChI | InChI=1S/C25H23BNO3S/c1-24(2,28)25(3,4)30-26-17-11-8-12-19-22(17)16-13-21-18(14-20(16)29-19)27-23(31-21)15-9-6-5-7-10-15/h5-14,28H,1-4H3 |
| InChIKey | XPJHAAPURZEMNA-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.34 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|