C20H29BFN3O2 — CID 174014083
2-(4-fluoro-6-methylcyclohexa-1,3-dien-1-yl)-5-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine (PubChem CID 174014083) has the molecular formula C20H29BFN3O2 and a molecular weight of 373.28 g/mol. Its IUPAC name is 2-(4-fluoro-6-methylcyclohexa-1,3-dien-1-yl)-5-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine.
| Compound Name | 2-(4-fluoro-6-methylcyclohexa-1,3-dien-1-yl)-5-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 174014083 |
| Molecular Formula | C20H29BFN3O2 |
| Molecular Weight | 373.28 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | 2-(4-fluoro-6-methylcyclohexa-1,3-dien-1-yl)-5-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine |
| SMILES | CC1CC(F)=CC=C1c1nn2c(c1B1OC(C)(C)C(C)(C)O1)CN(C)CC2 |
| InChI | InChI=1S/C20H29BFN3O2/c1-13-11-14(22)7-8-15(13)18-17(16-12-24(6)9-10-25(16)23-18)21-26-19(2,3)20(4,5)27-21/h7-8,13H,9-12H2,1-6H3 |
| InChIKey | MPJQOMVAILQPNE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.28 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|