C21H20B3ClFNO2 — CID 174020202
CID 174020202 (PubChem CID 174020202) has the molecular formula C21H20B3ClFNO2 and a molecular weight of 405.28 g/mol.
| Compound Name | CID 174020202 |
|---|---|
| PubChem CID | 174020202 |
| Molecular Formula | C21H20B3ClFNO2 |
| Molecular Weight | 405.28 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])c1ccc(C2CCCN2C(=O)C(C)(C)Oc2ccc(Cl)cc2F)cc1 |
| InChI | InChI=1S/C21H20B3ClFNO2/c1-20(2,29-18-10-9-15(25)12-16(18)26)19(28)27-11-3-4-17(27)13-5-7-14(8-6-13)21(22,23)24/h5-10,12,17H,3-4,11H2,1-2H3 |
| InChIKey | FJLWTRFFHFXGDW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.28 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|