C22H23ClN2O3 — CID 164807329
1-[2-(4-chlorophenyl)pyrrolidin-1-yl]-2-(4-isocyano-2-methoxyphenoxy)-2-methylpropan-1-one (PubChem CID 164807329) has the molecular formula C22H23ClN2O3 and a molecular weight of 398.89 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)pyrrolidin-1-yl]-2-(4-isocyano-2-methoxyphenoxy)-2-methylpropan-1-one.
| Compound Name | 1-[2-(4-chlorophenyl)pyrrolidin-1-yl]-2-(4-isocyano-2-methoxyphenoxy)-2-methylpropan-1-one |
|---|---|
| PubChem CID | 164807329 |
| Molecular Formula | C22H23ClN2O3 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 1-[2-(4-chlorophenyl)pyrrolidin-1-yl]-2-(4-isocyano-2-methoxyphenoxy)-2-methylpropan-1-one |
| SMILES | [C-]#[N+]c1ccc(OC(C)(C)C(=O)N2CCCC2c2ccc(Cl)cc2)c(OC)c1 |
| InChI | InChI=1S/C22H23ClN2O3/c1-22(2,28-19-12-11-17(24-3)14-20(19)27-4)21(26)25-13-5-6-18(25)15-7-9-16(23)10-8-15/h7-12,14,18H,5-6,13H2,1-2,4H3 |
| InChIKey | UMCGYMQEBFDAGP-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 43.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|