C15H24FO10P — CID 174020737
[(2R)-2-acetyloxy-3-[(2S,4S)-4-acetyloxy-2-fluoro-1-methoxypentan-3-yl]oxy-3-phosphorosooxypropyl] acetate (PubChem CID 174020737) has the molecular formula C15H24FO10P and a molecular weight of 414.32 g/mol. Its IUPAC name is [(2R)-2-acetyloxy-3-[(2S,4S)-4-acetyloxy-2-fluoro-1-methoxypentan-3-yl]oxy-3-phosphorosooxypropyl] acetate.
| Compound Name | [(2R)-2-acetyloxy-3-[(2S,4S)-4-acetyloxy-2-fluoro-1-methoxypentan-3-yl]oxy-3-phosphorosooxypropyl] acetate |
|---|---|
| PubChem CID | 174020737 |
| Molecular Formula | C15H24FO10P |
| Molecular Weight | 414.32 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | [(2R)-2-acetyloxy-3-[(2S,4S)-4-acetyloxy-2-fluoro-1-methoxypentan-3-yl]oxy-3-phosphorosooxypropyl] acetate |
| SMILES | COC[C@H](F)C(OC(OP=O)[C@@H](COC(C)=O)OC(C)=O)[C@H](C)OC(C)=O |
| InChI | InChI=1S/C15H24FO10P/c1-8(23-10(3)18)14(12(16)6-21-5)25-15(26-27-20)13(24-11(4)19)7-22-9(2)17/h8,12-15H,6-7H2,1-5H3/t8-,12-,13+,14?,15?/m0/s1 |
| InChIKey | XONZWVZWALKUMS-GBPNWZPQSA-N |
| XLogP | 1.35 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.32 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|