C15H23BrO9 — CID 126706951
[(3S)-3-acetyloxy-2-[(1R,2R)-2,3-diacetyloxy-1-bromopropoxy]butyl] acetate (PubChem CID 126706951) has the molecular formula C15H23BrO9 and a molecular weight of 427.24 g/mol. Its IUPAC name is [(3S)-3-acetyloxy-2-[(1R,2R)-2,3-diacetyloxy-1-bromopropoxy]butyl] acetate.
| Compound Name | [(3S)-3-acetyloxy-2-[(1R,2R)-2,3-diacetyloxy-1-bromopropoxy]butyl] acetate |
|---|---|
| PubChem CID | 126706951 |
| Molecular Formula | C15H23BrO9 |
| Molecular Weight | 427.24 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | [(3S)-3-acetyloxy-2-[(1R,2R)-2,3-diacetyloxy-1-bromopropoxy]butyl] acetate |
| SMILES | CC(=O)OCC(O[C@H](Br)[C@@H](COC(C)=O)OC(C)=O)[C@H](C)OC(C)=O |
| InChI | InChI=1S/C15H23BrO9/c1-8(23-11(4)19)13(6-21-9(2)17)25-15(16)14(24-12(5)20)7-22-10(3)18/h8,13-15H,6-7H2,1-5H3/t8-,13?,14+,15-/m0/s1 |
| InChIKey | XJORQZOSEDRQSB-QCZGFKKFSA-N |
| XLogP | 1.10 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.24 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|