C20H36O10S — CID 145311587
[3-acetyloxy-2-[(2S)-2,3-diacetyloxy-1-[2-(trimethyl-λ4-sulfanyl)ethoxy]propoxy]butyl] acetate (PubChem CID 145311587) has the molecular formula C20H36O10S and a molecular weight of 468.57 g/mol. Its IUPAC name is [3-acetyloxy-2-[(2S)-2,3-diacetyloxy-1-[2-(trimethyl-λ4-sulfanyl)ethoxy]propoxy]butyl] acetate.
| Compound Name | [3-acetyloxy-2-[(2S)-2,3-diacetyloxy-1-[2-(trimethyl-λ4-sulfanyl)ethoxy]propoxy]butyl] acetate |
|---|---|
| PubChem CID | 145311587 |
| Molecular Formula | C20H36O10S |
| Molecular Weight | 468.57 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | [3-acetyloxy-2-[(2S)-2,3-diacetyloxy-1-[2-(trimethyl-λ4-sulfanyl)ethoxy]propoxy]butyl] acetate |
| SMILES | CC(=O)OCC(OC(OCCS(C)(C)C)[C@H](COC(C)=O)OC(C)=O)C(C)OC(C)=O |
| InChI | InChI=1S/C20H36O10S/c1-13(28-16(4)23)18(11-26-14(2)21)30-20(25-9-10-31(6,7)8)19(29-17(5)24)12-27-15(3)22/h13,18-20H,9-12H2,1-8H3/t13?,18?,19-,20?/m0/s1 |
| InChIKey | YPUVZNKEMHGRMO-XJYAOJGJSA-N |
| XLogP | 1.42 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.57 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|