C17H29ClO10 — CID 89419676
2-[(1R,2S)-2,3-diacetyloxy-1-[2-[2-(2-chloroethoxy)ethoxy]ethoxy]propoxy]ethyl acetate (PubChem CID 89419676) has the molecular formula C17H29ClO10 and a molecular weight of 428.86 g/mol. Its IUPAC name is 2-[(1R,2S)-2,3-diacetyloxy-1-[2-[2-(2-chloroethoxy)ethoxy]ethoxy]propoxy]ethyl acetate.
| Compound Name | 2-[(1R,2S)-2,3-diacetyloxy-1-[2-[2-(2-chloroethoxy)ethoxy]ethoxy]propoxy]ethyl acetate |
|---|---|
| PubChem CID | 89419676 |
| Molecular Formula | C17H29ClO10 |
| Molecular Weight | 428.86 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 2-[(1R,2S)-2,3-diacetyloxy-1-[2-[2-(2-chloroethoxy)ethoxy]ethoxy]propoxy]ethyl acetate |
| SMILES | CC(=O)OCCOC(OCCOCCOCCCl)[C@H](COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C17H29ClO10/c1-13(19)24-10-11-26-17(16(28-15(3)21)12-27-14(2)20)25-9-8-23-7-6-22-5-4-18/h16-17H,4-12H2,1-3H3/t16-,17?/m0/s1 |
| InChIKey | CLCKJRLHNPDSAM-BHWOMJMDSA-N |
| XLogP | 0.68 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.86 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|