C10H13N5O — CID 174020763
6-(dimethylaminomethylideneamino)-N-(methylideneamino)pyridine-2-carboxamide (PubChem CID 174020763) has the molecular formula C10H13N5O and a molecular weight of 219.25 g/mol. Its IUPAC name is 6-(dimethylaminomethylideneamino)-N-(methylideneamino)pyridine-2-carboxamide.
| Compound Name | 6-(dimethylaminomethylideneamino)-N-(methylideneamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 174020763 |
| Molecular Formula | C10H13N5O |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 6-(dimethylaminomethylideneamino)-N-(methylideneamino)pyridine-2-carboxamide |
| SMILES | C=NNC(=O)c1cccc(N=CN(C)C)n1 |
| InChI | InChI=1S/C10H13N5O/c1-11-14-10(16)8-5-4-6-9(13-8)12-7-15(2)3/h4-7H,1H2,2-3H3,(H,14,16) |
| InChIKey | DWSVTOJVHLXIEX-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 69.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|