C12H18N6O — CID 123676409
N,6-bis(dimethylaminomethylideneamino)pyridine-2-carboxamide (PubChem CID 123676409) has the molecular formula C12H18N6O and a molecular weight of 262.32 g/mol. Its IUPAC name is N,6-bis(dimethylaminomethylideneamino)pyridine-2-carboxamide.
| Compound Name | N,6-bis(dimethylaminomethylideneamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 123676409 |
| Molecular Formula | C12H18N6O |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | N,6-bis(dimethylaminomethylideneamino)pyridine-2-carboxamide |
| SMILES | CN(C)C=NNC(=O)c1cccc(N=CN(C)C)n1 |
| InChI | InChI=1S/C12H18N6O/c1-17(2)8-13-11-7-5-6-10(15-11)12(19)16-14-9-18(3)4/h5-9H,1-4H3,(H,16,19) |
| InChIKey | DGFRHQOYTZYTTM-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 73.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|