C15H21N7O3 — CID 174072630
6-[[3-amino-3-methoxy-2-(methyliminomethyl)prop-2-enoyl]amino]-N-[(Z)-dimethylaminomethylideneamino]pyridine-2-carboxamide (PubChem CID 174072630) has the molecular formula C15H21N7O3 and a molecular weight of 347.38 g/mol. Its IUPAC name is 6-[[3-amino-3-methoxy-2-(methyliminomethyl)prop-2-enoyl]amino]-N-[(Z)-dimethylaminomethylideneamino]pyridine-2-carboxamide.
| Compound Name | 6-[[3-amino-3-methoxy-2-(methyliminomethyl)prop-2-enoyl]amino]-N-[(Z)-dimethylaminomethylideneamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 174072630 |
| Molecular Formula | C15H21N7O3 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 6-[[3-amino-3-methoxy-2-(methyliminomethyl)prop-2-enoyl]amino]-N-[(Z)-dimethylaminomethylideneamino]pyridine-2-carboxamide |
| SMILES | C/N=C/C(C(=O)Nc1cccc(C(=O)N/N=C\N(C)C)n1)=C(N)OC |
| InChI | InChI=1S/C15H21N7O3/c1-17-8-10(13(16)25-4)14(23)20-12-7-5-6-11(19-12)15(24)21-18-9-22(2)3/h5-9H,16H2,1-4H3,(H,21,24)(H,19,20,23)/b13-10?,17-8+,18-9- |
| InChIKey | YUUBPUZBGORBRX-HRRKUCNZSA-N |
| XLogP | -0.23 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|