C11H21F2N — CID 174023168
(E)-1-fluoro-N-(fluoromethyl)-2,4-dimethyl-N-propan-2-ylpent-2-en-3-amine (PubChem CID 174023168) has the molecular formula C11H21F2N and a molecular weight of 205.29 g/mol. Its IUPAC name is (E)-1-fluoro-N-(fluoromethyl)-2,4-dimethyl-N-propan-2-ylpent-2-en-3-amine.
| Compound Name | (E)-1-fluoro-N-(fluoromethyl)-2,4-dimethyl-N-propan-2-ylpent-2-en-3-amine |
|---|---|
| PubChem CID | 174023168 |
| Molecular Formula | C11H21F2N |
| Molecular Weight | 205.29 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | (E)-1-fluoro-N-(fluoromethyl)-2,4-dimethyl-N-propan-2-ylpent-2-en-3-amine |
| SMILES | C/C(CF)=C(/C(C)C)N(CF)C(C)C |
| InChI | InChI=1S/C11H21F2N/c1-8(2)11(10(5)6-12)14(7-13)9(3)4/h8-9H,6-7H2,1-5H3/b11-10+ |
| InChIKey | LLUFMKGQQPBKIG-ZHACJKMWSA-N |
| XLogP | 3.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.29 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|