C9H9F10N — CID 160565377
4,4,5,5,5-pentafluoro-N,2-dimethyl-N-(1,1,2,2,2-pentafluoroethyl)pent-2-en-3-amine (PubChem CID 160565377) has the molecular formula C9H9F10N and a molecular weight of 321.16 g/mol. Its IUPAC name is 4,4,5,5,5-pentafluoro-N,2-dimethyl-N-(1,1,2,2,2-pentafluoroethyl)pent-2-en-3-amine.
| Compound Name | 4,4,5,5,5-pentafluoro-N,2-dimethyl-N-(1,1,2,2,2-pentafluoroethyl)pent-2-en-3-amine |
|---|---|
| PubChem CID | 160565377 |
| Molecular Formula | C9H9F10N |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 4,4,5,5,5-pentafluoro-N,2-dimethyl-N-(1,1,2,2,2-pentafluoroethyl)pent-2-en-3-amine |
| SMILES | CC(C)=C(N(C)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H9F10N/c1-4(2)5(6(10,11)7(12,13)14)20(3)9(18,19)8(15,16)17/h1-3H3 |
| InChIKey | JOIXMVLODWUKQR-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|