C9H3F16N — CID 163983716
(Z)-1,1,1,4,4,5,5,5-octafluoro-2-methyl-N-(1,1,2,2,2-pentafluoroethyl)-N-(trifluoromethyl)pent-2-en-3-amine (PubChem CID 163983716) has the molecular formula C9H3F16N and a molecular weight of 429.10 g/mol. Its IUPAC name is (Z)-1,1,1,4,4,5,5,5-octafluoro-2-methyl-N-(1,1,2,2,2-pentafluoroethyl)-N-(trifluoromethyl)pent-2-en-3-amine.
| Compound Name | (Z)-1,1,1,4,4,5,5,5-octafluoro-2-methyl-N-(1,1,2,2,2-pentafluoroethyl)-N-(trifluoromethyl)pent-2-en-3-amine |
|---|---|
| PubChem CID | 163983716 |
| Molecular Formula | C9H3F16N |
| Molecular Weight | 429.10 g/mol |
| Exact Mass | 429.00 |
| IUPAC Name | (Z)-1,1,1,4,4,5,5,5-octafluoro-2-methyl-N-(1,1,2,2,2-pentafluoroethyl)-N-(trifluoromethyl)pent-2-en-3-amine |
| SMILES | C/C(=C(/N(C(F)(F)F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H3F16N/c1-2(5(12,13)14)3(4(10,11)6(15,16)17)26(9(23,24)25)8(21,22)7(18,19)20/h1H3/b3-2- |
| InChIKey | TUMHRXVAPSLIRN-IHWYPQMZSA-N |
| XLogP | 6.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.10 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|