C10H6F15N — CID 160565381
4,4,5,5,5-pentafluoro-2-methyl-N,N-bis(1,1,2,2,2-pentafluoroethyl)pent-2-en-3-amine (PubChem CID 160565381) has the molecular formula C10H6F15N and a molecular weight of 425.14 g/mol. Its IUPAC name is 4,4,5,5,5-pentafluoro-2-methyl-N,N-bis(1,1,2,2,2-pentafluoroethyl)pent-2-en-3-amine.
| Compound Name | 4,4,5,5,5-pentafluoro-2-methyl-N,N-bis(1,1,2,2,2-pentafluoroethyl)pent-2-en-3-amine |
|---|---|
| PubChem CID | 160565381 |
| Molecular Formula | C10H6F15N |
| Molecular Weight | 425.14 g/mol |
| Exact Mass | 425.03 |
| IUPAC Name | 4,4,5,5,5-pentafluoro-2-methyl-N,N-bis(1,1,2,2,2-pentafluoroethyl)pent-2-en-3-amine |
| SMILES | CC(C)=C(N(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H6F15N/c1-3(2)4(5(11,12)6(13,14)15)26(9(22,23)7(16,17)18)10(24,25)8(19,20)21/h1-2H3 |
| InChIKey | PVUDBEKRPBFWFL-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.14 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|