C9H3F16N — CID 160565378
2,4,4,5,5,5-hexafluoro-N,N-bis(1,1,2,2,2-pentafluoroethyl)pent-2-en-3-amine (PubChem CID 160565378) has the molecular formula C9H3F16N and a molecular weight of 429.10 g/mol. Its IUPAC name is 2,4,4,5,5,5-hexafluoro-N,N-bis(1,1,2,2,2-pentafluoroethyl)pent-2-en-3-amine.
| Compound Name | 2,4,4,5,5,5-hexafluoro-N,N-bis(1,1,2,2,2-pentafluoroethyl)pent-2-en-3-amine |
|---|---|
| PubChem CID | 160565378 |
| Molecular Formula | C9H3F16N |
| Molecular Weight | 429.10 g/mol |
| Exact Mass | 429.00 |
| IUPAC Name | 2,4,4,5,5,5-hexafluoro-N,N-bis(1,1,2,2,2-pentafluoroethyl)pent-2-en-3-amine |
| SMILES | CC(F)=C(N(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H3F16N/c1-2(10)3(4(11,12)5(13,14)15)26(8(22,23)6(16,17)18)9(24,25)7(19,20)21/h1H3 |
| InChIKey | WZCUGMBPNXXPJE-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.10 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|