C8H6F11N — CID 160982574
2,4,4,5,5,5-hexafluoro-N-methyl-N-(1,1,2,2,2-pentafluoroethyl)pent-2-en-3-amine (PubChem CID 160982574) has the molecular formula C8H6F11N and a molecular weight of 325.12 g/mol. Its IUPAC name is 2,4,4,5,5,5-hexafluoro-N-methyl-N-(1,1,2,2,2-pentafluoroethyl)pent-2-en-3-amine.
| Compound Name | 2,4,4,5,5,5-hexafluoro-N-methyl-N-(1,1,2,2,2-pentafluoroethyl)pent-2-en-3-amine |
|---|---|
| PubChem CID | 160982574 |
| Molecular Formula | C8H6F11N |
| Molecular Weight | 325.12 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | 2,4,4,5,5,5-hexafluoro-N-methyl-N-(1,1,2,2,2-pentafluoroethyl)pent-2-en-3-amine |
| SMILES | CC(F)=C(N(C)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H6F11N/c1-3(9)4(5(10,11)6(12,13)14)20(2)8(18,19)7(15,16)17/h1-2H3 |
| InChIKey | FRGDKOKUQGHWJZ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.12 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|