C12H6F19N — CID 160565387
4,4,5,5,5-pentafluoro-N,N-bis(1,1,2,2,3,3,3-heptafluoropropyl)-2-methylpent-2-en-3-amine (PubChem CID 160565387) has the molecular formula C12H6F19N and a molecular weight of 525.15 g/mol. Its IUPAC name is 4,4,5,5,5-pentafluoro-N,N-bis(1,1,2,2,3,3,3-heptafluoropropyl)-2-methylpent-2-en-3-amine.
| Compound Name | 4,4,5,5,5-pentafluoro-N,N-bis(1,1,2,2,3,3,3-heptafluoropropyl)-2-methylpent-2-en-3-amine |
|---|---|
| PubChem CID | 160565387 |
| Molecular Formula | C12H6F19N |
| Molecular Weight | 525.15 g/mol |
| Exact Mass | 525.02 |
| IUPAC Name | 4,4,5,5,5-pentafluoro-N,N-bis(1,1,2,2,3,3,3-heptafluoropropyl)-2-methylpent-2-en-3-amine |
| SMILES | CC(C)=C(N(C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H6F19N/c1-3(2)4(5(13,14)8(19,20)21)32(11(28,29)6(15,16)9(22,23)24)12(30,31)7(17,18)10(25,26)27/h1-2H3 |
| InChIKey | PQQOULQMJPSYSW-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.15 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|