C25H25N7 — CID 174025637
1-phenyl-3-(7-piperidin-1-yl-2-pyridin-2-ylpyrazolo[1,5-a]pyrimidin-5-yl)iminoprop-1-en-1-amine (PubChem CID 174025637) has the molecular formula C25H25N7 and a molecular weight of 423.52 g/mol. Its IUPAC name is 1-phenyl-3-(7-piperidin-1-yl-2-pyridin-2-ylpyrazolo[1,5-a]pyrimidin-5-yl)iminoprop-1-en-1-amine.
| Compound Name | 1-phenyl-3-(7-piperidin-1-yl-2-pyridin-2-ylpyrazolo[1,5-a]pyrimidin-5-yl)iminoprop-1-en-1-amine |
|---|---|
| PubChem CID | 174025637 |
| Molecular Formula | C25H25N7 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | 1-phenyl-3-(7-piperidin-1-yl-2-pyridin-2-ylpyrazolo[1,5-a]pyrimidin-5-yl)iminoprop-1-en-1-amine |
| SMILES | NC(=C/C=N/c1cc(N2CCCCC2)n2nc(-c3ccccn3)cc2n1)c1ccccc1 |
| InChI | InChI=1S/C25H25N7/c26-20(19-9-3-1-4-10-19)12-14-28-23-18-25(31-15-7-2-8-16-31)32-24(29-23)17-22(30-32)21-11-5-6-13-27-21/h1,3-6,9-14,17-18H,2,7-8,15-16,26H2/b20-12?,28-14+ |
| InChIKey | YQPWSQKHXCTLLZ-YDRRHDMGSA-N |
| XLogP | 4.48 |
| TPSA | 84.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|