C27H32BN3O5 — CID 174027316
ethyl N-[3-(isoquinolin-6-ylamino)-3-oxo-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propyl]carbamate (PubChem CID 174027316) has the molecular formula C27H32BN3O5 and a molecular weight of 489.38 g/mol. Its IUPAC name is ethyl N-[3-(isoquinolin-6-ylamino)-3-oxo-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propyl]carbamate.
| Compound Name | ethyl N-[3-(isoquinolin-6-ylamino)-3-oxo-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propyl]carbamate |
|---|---|
| PubChem CID | 174027316 |
| Molecular Formula | C27H32BN3O5 |
| Molecular Weight | 489.38 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | ethyl N-[3-(isoquinolin-6-ylamino)-3-oxo-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propyl]carbamate |
| SMILES | CCOC(=O)NCC(C(=O)Nc1ccc2cnccc2c1)c1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C27H32BN3O5/c1-6-34-25(33)30-17-23(24(32)31-22-12-9-20-16-29-14-13-19(20)15-22)18-7-10-21(11-8-18)28-35-26(2,3)27(4,5)36-28/h7-16,23H,6,17H2,1-5H3,(H,30,33)(H,31,32) |
| InChIKey | CXEFZJWBHIPRHO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|