C30H40BN3O5S — CID 174027254
2-(trimethyl-λ4-sulfanyl)ethyl N-[3-(isoquinolin-6-ylamino)-3-oxo-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propyl]carbamate (PubChem CID 174027254) has the molecular formula C30H40BN3O5S and a molecular weight of 565.55 g/mol. Its IUPAC name is 2-(trimethyl-λ4-sulfanyl)ethyl N-[3-(isoquinolin-6-ylamino)-3-oxo-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propyl]carbamate.
| Compound Name | 2-(trimethyl-λ4-sulfanyl)ethyl N-[3-(isoquinolin-6-ylamino)-3-oxo-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propyl]carbamate |
|---|---|
| PubChem CID | 174027254 |
| Molecular Formula | C30H40BN3O5S |
| Molecular Weight | 565.55 g/mol |
| Exact Mass | 565.28 |
| IUPAC Name | 2-(trimethyl-λ4-sulfanyl)ethyl N-[3-(isoquinolin-6-ylamino)-3-oxo-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propyl]carbamate |
| SMILES | CC1(C)OB(c2ccc(C(CNC(=O)OCCS(C)(C)C)C(=O)Nc3ccc4cnccc4c3)cc2)OC1(C)C |
| InChI | InChI=1S/C30H40BN3O5S/c1-29(2)30(3,4)39-31(38-29)24-11-8-21(9-12-24)26(20-33-28(36)37-16-17-40(5,6)7)27(35)34-25-13-10-23-19-32-15-14-22(23)18-25/h8-15,18-19,26H,16-17,20H2,1-7H3,(H,33,36)(H,34,35) |
| InChIKey | OTSZHIHLEAYIAS-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.55 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|