C24H21ClFN4O4Si — CID 174027663
CID 174027663 (PubChem CID 174027663) has the molecular formula C24H21ClFN4O4Si and a molecular weight of 511.99 g/mol.
| Compound Name | CID 174027663 |
|---|---|
| PubChem CID | 174027663 |
| Molecular Formula | C24H21ClFN4O4Si |
| Molecular Weight | 511.99 g/mol |
| Exact Mass | 511.10 |
| IUPAC Name | — |
| SMILES | O=C1CC[C@H](N2Cc3cc(C(=O)N[C@H](c4ncccc4Cl)C4(F)CC4)ccc3C2=O)C([Si])C(=O)N1 |
| InChI | InChI=1S/C24H21ClFN4O4Si/c25-15-2-1-9-27-18(15)20(24(26)7-8-24)29-21(32)12-3-4-14-13(10-12)11-30(23(14)34)16-5-6-17(31)28-22(33)19(16)35/h1-4,9-10,16,19-20H,5-8,11H2,(H,29,32)(H,28,31,33)/t16-,19?,20+/m0/s1 |
| InChIKey | IJWCDZBQLASQIN-OOFVQCGSSA-N |
| XLogP | 2.43 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.99 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|