C25H23ClFN4O4Si — CID 174027638
CID 174027638 (PubChem CID 174027638) has the molecular formula C25H23ClFN4O4Si and a molecular weight of 526.02 g/mol.
| Compound Name | CID 174027638 |
|---|---|
| PubChem CID | 174027638 |
| Molecular Formula | C25H23ClFN4O4Si |
| Molecular Weight | 526.02 g/mol |
| Exact Mass | 525.12 |
| IUPAC Name | — |
| SMILES | O=C1CC[C@H](N2Cc3cc(C(=O)N[C@H](c4ncccc4Cl)C4(F)CCC4)ccc3C2=O)C([Si])C(=O)N1 |
| InChI | InChI=1S/C25H23ClFN4O4Si/c26-16-3-1-10-28-19(16)21(25(27)8-2-9-25)30-22(33)13-4-5-15-14(11-13)12-31(24(15)35)17-6-7-18(32)29-23(34)20(17)36/h1,3-5,10-11,17,20-21H,2,6-9,12H2,(H,30,33)(H,29,32,34)/t17-,20?,21+/m0/s1 |
| InChIKey | WCSGUVUXXLROKV-ADFYKPTQSA-N |
| XLogP | 2.82 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.02 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|