C14H21BN — CID 174030849
CID 174030849 (PubChem CID 174030849) has the molecular formula C14H21BN and a molecular weight of 214.14 g/mol.
| Compound Name | CID 174030849 |
|---|---|
| PubChem CID | 174030849 |
| Molecular Formula | C14H21BN |
| Molecular Weight | 214.14 g/mol |
| Exact Mass | 214.18 |
| IUPAC Name | — |
| SMILES | C[B]c1cccc2c1CCCCN2C(C)C |
| InChI | InChI=1S/C14H21BN/c1-11(2)16-10-5-4-7-12-13(15-3)8-6-9-14(12)16/h6,8-9,11H,4-5,7,10H2,1-3H3 |
| InChIKey | JGGUVPPIYGSOSZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.14 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|