C18H16FN9 — CID 174035508
3-[4-amino-5-fluoro-6-[2-(1H-pyrazol-5-ylmethylimino)ethanehydrazonoyl]pyrimidin-2-yl]-2-methylbenzonitrile (PubChem CID 174035508) has the molecular formula C18H16FN9 and a molecular weight of 377.39 g/mol. Its IUPAC name is 3-[4-amino-5-fluoro-6-[2-(1H-pyrazol-5-ylmethylimino)ethanehydrazonoyl]pyrimidin-2-yl]-2-methylbenzonitrile.
| Compound Name | 3-[4-amino-5-fluoro-6-[2-(1H-pyrazol-5-ylmethylimino)ethanehydrazonoyl]pyrimidin-2-yl]-2-methylbenzonitrile |
|---|---|
| PubChem CID | 174035508 |
| Molecular Formula | C18H16FN9 |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 3-[4-amino-5-fluoro-6-[2-(1H-pyrazol-5-ylmethylimino)ethanehydrazonoyl]pyrimidin-2-yl]-2-methylbenzonitrile |
| SMILES | Cc1c(C#N)cccc1-c1nc(N)c(F)c(C(/C=N/Cc2ccn[nH]2)=NN)n1 |
| InChI | InChI=1S/C18H16FN9/c1-10-11(7-20)3-2-4-13(10)18-25-16(15(19)17(21)26-18)14(27-22)9-23-8-12-5-6-24-28-12/h2-6,9H,8,22H2,1H3,(H,24,28)(H2,21,25,26)/b23-9+,27-14? |
| InChIKey | RSCVBHRRRQTOBI-NYFGQNIESA-N |
| XLogP | 1.70 |
| TPSA | 155.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|