C21H20FN9 — CID 174035506
3-[4-amino-6-[2-[(1-cyclopropylpyrazol-3-yl)methylimino]ethanehydrazonoyl]-5-fluoropyrimidin-2-yl]-2-methylbenzonitrile (PubChem CID 174035506) has the molecular formula C21H20FN9 and a molecular weight of 417.45 g/mol. Its IUPAC name is 3-[4-amino-6-[2-[(1-cyclopropylpyrazol-3-yl)methylimino]ethanehydrazonoyl]-5-fluoropyrimidin-2-yl]-2-methylbenzonitrile.
| Compound Name | 3-[4-amino-6-[2-[(1-cyclopropylpyrazol-3-yl)methylimino]ethanehydrazonoyl]-5-fluoropyrimidin-2-yl]-2-methylbenzonitrile |
|---|---|
| PubChem CID | 174035506 |
| Molecular Formula | C21H20FN9 |
| Molecular Weight | 417.45 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 3-[4-amino-6-[2-[(1-cyclopropylpyrazol-3-yl)methylimino]ethanehydrazonoyl]-5-fluoropyrimidin-2-yl]-2-methylbenzonitrile |
| SMILES | Cc1c(C#N)cccc1-c1nc(N)c(F)c(C(/C=N/Cc2ccn(C3CC3)n2)=NN)n1 |
| InChI | InChI=1S/C21H20FN9/c1-12-13(9-23)3-2-4-16(12)21-27-19(18(22)20(24)28-21)17(29-25)11-26-10-14-7-8-31(30-14)15-5-6-15/h2-4,7-8,11,15H,5-6,10,25H2,1H3,(H2,24,27,28)/b26-11+,29-17? |
| InChIKey | ZRDXWWCEGICLMW-XFWUGIHHSA-N |
| XLogP | 2.51 |
| TPSA | 144.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|