C22H21FN8O — CID 174035493
3-[4-amino-5-fluoro-6-[2-[[6-(methoxymethyl)-2-pyridinyl]methylimino]ethanehydrazonoyl]pyrimidin-2-yl]-2-methylbenzonitrile (PubChem CID 174035493) has the molecular formula C22H21FN8O and a molecular weight of 432.46 g/mol. Its IUPAC name is 3-[4-amino-5-fluoro-6-[2-[[6-(methoxymethyl)-2-pyridinyl]methylimino]ethanehydrazonoyl]pyrimidin-2-yl]-2-methylbenzonitrile.
| Compound Name | 3-[4-amino-5-fluoro-6-[2-[[6-(methoxymethyl)-2-pyridinyl]methylimino]ethanehydrazonoyl]pyrimidin-2-yl]-2-methylbenzonitrile |
|---|---|
| PubChem CID | 174035493 |
| Molecular Formula | C22H21FN8O |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 3-[4-amino-5-fluoro-6-[2-[[6-(methoxymethyl)-2-pyridinyl]methylimino]ethanehydrazonoyl]pyrimidin-2-yl]-2-methylbenzonitrile |
| SMILES | COCc1cccc(C/N=C/C(=NN)c2nc(-c3cccc(C#N)c3C)nc(N)c2F)n1 |
| InChI | InChI=1S/C22H21FN8O/c1-13-14(9-24)5-3-8-17(13)22-29-20(19(23)21(25)30-22)18(31-26)11-27-10-15-6-4-7-16(28-15)12-32-2/h3-8,11H,10,12,26H2,1-2H3,(H2,25,29,30)/b27-11+,31-18? |
| InChIKey | ZKVXNETXFZESTR-CHMJCDIESA-N |
| XLogP | 2.52 |
| TPSA | 148.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|