C20H20F3N7O — CID 157397619
(2S)-2-[6-[[[2-(2-amino-8-methylquinazolin-4-yl)-2-hydrazinylideneethylidene]amino]methyl]-2-pyridinyl]-1,1,1-trifluoropropan-2-ol (PubChem CID 157397619) has the molecular formula C20H20F3N7O and a molecular weight of 431.42 g/mol. Its IUPAC name is (2S)-2-[6-[[[2-(2-amino-8-methylquinazolin-4-yl)-2-hydrazinylideneethylidene]amino]methyl]-2-pyridinyl]-1,1,1-trifluoropropan-2-ol.
| Compound Name | (2S)-2-[6-[[[2-(2-amino-8-methylquinazolin-4-yl)-2-hydrazinylideneethylidene]amino]methyl]-2-pyridinyl]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 157397619 |
| Molecular Formula | C20H20F3N7O |
| Molecular Weight | 431.42 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | (2S)-2-[6-[[[2-(2-amino-8-methylquinazolin-4-yl)-2-hydrazinylideneethylidene]amino]methyl]-2-pyridinyl]-1,1,1-trifluoropropan-2-ol |
| SMILES | Cc1cccc2c(C(/C=N/Cc3cccc([C@](C)(O)C(F)(F)F)n3)=NN)nc(N)nc12 |
| InChI | InChI=1S/C20H20F3N7O/c1-11-5-3-7-13-16(11)28-18(24)29-17(13)14(30-25)10-26-9-12-6-4-8-15(27-12)19(2,31)20(21,22)23/h3-8,10,31H,9,25H2,1-2H3,(H2,24,28,29)/b26-10+,30-14?/t19-/m0/s1 |
| InChIKey | OTAGTUAPIHCUMH-QKUCRSHVSA-N |
| XLogP | 2.62 |
| TPSA | 135.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.42 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|