C24H25ClN8O2 — CID 174035478
3-[4-amino-5-chloro-6-[2-[[1-(2-hydroxy-2-methylpropyl)-2-oxo-3-pyridinyl]methylimino]ethanehydrazonoyl]pyrimidin-2-yl]-2-methylbenzonitrile (PubChem CID 174035478) has the molecular formula C24H25ClN8O2 and a molecular weight of 492.97 g/mol. Its IUPAC name is 3-[4-amino-5-chloro-6-[2-[[1-(2-hydroxy-2-methylpropyl)-2-oxo-3-pyridinyl]methylimino]ethanehydrazonoyl]pyrimidin-2-yl]-2-methylbenzonitrile.
| Compound Name | 3-[4-amino-5-chloro-6-[2-[[1-(2-hydroxy-2-methylpropyl)-2-oxo-3-pyridinyl]methylimino]ethanehydrazonoyl]pyrimidin-2-yl]-2-methylbenzonitrile |
|---|---|
| PubChem CID | 174035478 |
| Molecular Formula | C24H25ClN8O2 |
| Molecular Weight | 492.97 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | 3-[4-amino-5-chloro-6-[2-[[1-(2-hydroxy-2-methylpropyl)-2-oxo-3-pyridinyl]methylimino]ethanehydrazonoyl]pyrimidin-2-yl]-2-methylbenzonitrile |
| SMILES | Cc1c(C#N)cccc1-c1nc(N)c(Cl)c(C(/C=N/Cc2cccn(CC(C)(C)O)c2=O)=NN)n1 |
| InChI | InChI=1S/C24H25ClN8O2/c1-14-15(10-26)6-4-8-17(14)22-30-20(19(25)21(27)31-22)18(32-28)12-29-11-16-7-5-9-33(23(16)34)13-24(2,3)35/h4-9,12,35H,11,13,28H2,1-3H3,(H2,27,30,31)/b29-12+,32-18? |
| InChIKey | ZGUUWOQDINRTHY-YGOQXWKZSA-N |
| XLogP | 2.43 |
| TPSA | 168.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.97 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|