C17H15Cl2N5O3S2 — CID 174038592
4-chloro-2-[[4-(4-chloro-1,3-thiazol-2-yl)triazol-1-yl]-[(3R)-1,3-dihydroxybutan-2-yl]oxymethyl]sulfanylbenzonitrile (PubChem CID 174038592) has the molecular formula C17H15Cl2N5O3S2 and a molecular weight of 472.38 g/mol. Its IUPAC name is 4-chloro-2-[[4-(4-chloro-1,3-thiazol-2-yl)triazol-1-yl]-[(3R)-1,3-dihydroxybutan-2-yl]oxymethyl]sulfanylbenzonitrile.
| Compound Name | 4-chloro-2-[[4-(4-chloro-1,3-thiazol-2-yl)triazol-1-yl]-[(3R)-1,3-dihydroxybutan-2-yl]oxymethyl]sulfanylbenzonitrile |
|---|---|
| PubChem CID | 174038592 |
| Molecular Formula | C17H15Cl2N5O3S2 |
| Molecular Weight | 472.38 g/mol |
| Exact Mass | 471.00 |
| IUPAC Name | 4-chloro-2-[[4-(4-chloro-1,3-thiazol-2-yl)triazol-1-yl]-[(3R)-1,3-dihydroxybutan-2-yl]oxymethyl]sulfanylbenzonitrile |
| SMILES | C[C@@H](O)C(CO)OC(Sc1cc(Cl)ccc1C#N)n1cc(-c2nc(Cl)cs2)nn1 |
| InChI | InChI=1S/C17H15Cl2N5O3S2/c1-9(26)13(7-25)27-17(29-14-4-11(18)3-2-10(14)5-20)24-6-12(22-23-24)16-21-15(19)8-28-16/h2-4,6,8-9,13,17,25-26H,7H2,1H3/t9-,13?,17?/m1/s1 |
| InChIKey | WVSDXFVYHYNXKS-GJQJZUFJSA-N |
| XLogP | 3.59 |
| TPSA | 117.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|