C13H25BN2 — CID 174041396
4-butyl-5-hexan-3-yl-1-methyl-1,3,2-diazaborole (PubChem CID 174041396) has the molecular formula C13H25BN2 and a molecular weight of 220.17 g/mol. Its IUPAC name is 4-butyl-5-hexan-3-yl-1-methyl-1,3,2-diazaborole.
| Compound Name | 4-butyl-5-hexan-3-yl-1-methyl-1,3,2-diazaborole |
|---|---|
| PubChem CID | 174041396 |
| Molecular Formula | C13H25BN2 |
| Molecular Weight | 220.17 g/mol |
| Exact Mass | 220.21 |
| IUPAC Name | 4-butyl-5-hexan-3-yl-1-methyl-1,3,2-diazaborole |
| SMILES | CCCCc1nbn(C)c1C(CC)CCC |
| InChI | InChI=1S/C13H25BN2/c1-5-8-10-12-13(16(4)14-15-12)11(7-3)9-6-2/h11H,5-10H2,1-4H3 |
| InChIKey | MKIUOKNTCFXGIT-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.17 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |