C13H21Cl — CID 174043737
(2R)-3-chloro-2,4,6,7-tetramethylbicyclo[5.2.0]non-3-ene (PubChem CID 174043737) has the molecular formula C13H21Cl and a molecular weight of 212.76 g/mol. Its IUPAC name is (2R)-3-chloro-2,4,6,7-tetramethylbicyclo[5.2.0]non-3-ene.
| Compound Name | (2R)-3-chloro-2,4,6,7-tetramethylbicyclo[5.2.0]non-3-ene |
|---|---|
| PubChem CID | 174043737 |
| Molecular Formula | C13H21Cl |
| Molecular Weight | 212.76 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | (2R)-3-chloro-2,4,6,7-tetramethylbicyclo[5.2.0]non-3-ene |
| SMILES | CC1=C(Cl)[C@H](C)C2CCC2(C)C(C)C1 |
| InChI | InChI=1S/C13H21Cl/c1-8-7-9(2)13(4)6-5-11(13)10(3)12(8)14/h9-11H,5-7H2,1-4H3/t9?,10-,11?,13?/m1/s1 |
| InChIKey | HZXADAOBWGBQMO-AQICRGNOSA-N |
| XLogP | 4.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.76 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |