C21H29O2Y+2 — CID 21023475
10-hydroxy-1,4,13,17-tetramethyl-6,7,8,9,11,12,14,15,16,17-decahydro-2H-cyclopenta[a]phenanthren-2-id-3-one;yttrium(3+) (PubChem CID 21023475) has the molecular formula C21H29O2Y+2 and a molecular weight of 402.37 g/mol. Its IUPAC name is 10-hydroxy-1,4,13,17-tetramethyl-6,7,8,9,11,12,14,15,16,17-decahydro-2H-cyclopenta[a]phenanthren-2-id-3-one;yttrium(3+).
| Compound Name | 10-hydroxy-1,4,13,17-tetramethyl-6,7,8,9,11,12,14,15,16,17-decahydro-2H-cyclopenta[a]phenanthren-2-id-3-one;yttrium(3+) |
|---|---|
| PubChem CID | 21023475 |
| Molecular Formula | C21H29O2Y+2 |
| Molecular Weight | 402.37 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 10-hydroxy-1,4,13,17-tetramethyl-6,7,8,9,11,12,14,15,16,17-decahydro-2H-cyclopenta[a]phenanthren-2-id-3-one;yttrium(3+) |
| SMILES | CC1=[C-]C(=O)C(C)=C2CCC3C(CCC4(C)C(C)CCC34)C12O.[Y+3] |
| InChI | InChI=1S/C21H29O2.Y/c1-12-5-7-17-15-6-8-16-14(3)19(22)11-13(2)21(16,23)18(15)9-10-20(12,17)4;/h12,15,17-18,23H,5-10H2,1-4H3;/q-1;+3 |
| InChIKey | PXMKDDXPBZUQCA-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.37 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|