C17H33NaO8 — CID 174048200
sodium;decyl (3R,4S,5R,6R)-3,4,5,6,7-pentahydroxy-2-oxoheptanoate;hydride (PubChem CID 174048200) has the molecular formula C17H33NaO8 and a molecular weight of 388.43 g/mol. Its IUPAC name is sodium;decyl (3R,4S,5R,6R)-3,4,5,6,7-pentahydroxy-2-oxoheptanoate;hydride.
| Compound Name | sodium;decyl (3R,4S,5R,6R)-3,4,5,6,7-pentahydroxy-2-oxoheptanoate;hydride |
|---|---|
| PubChem CID | 174048200 |
| Molecular Formula | C17H33NaO8 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | sodium;decyl (3R,4S,5R,6R)-3,4,5,6,7-pentahydroxy-2-oxoheptanoate;hydride |
| SMILES | CCCCCCCCCCOC(=O)C(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.[H-].[Na+] |
| InChI | InChI=1S/C17H32O8.Na.H/c1-2-3-4-5-6-7-8-9-10-25-17(24)16(23)15(22)14(21)13(20)12(19)11-18;;/h12-15,18-22H,2-11H2,1H3;;/q;+1;-1/t12-,13-,14+,15-;;/m1../s1 |
| InChIKey | OTSLVKSAAMMIBC-LRFIMVQDSA-N |
| XLogP | -3.21 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | -3.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|