C15H11N3OS — CID 17404827
4-(benzimidazol-1-ylmethyl)-2-thiophen-2-yl-1,3-oxazole (PubChem CID 17404827) has the molecular formula C15H11N3OS and a molecular weight of 281.34 g/mol. Its IUPAC name is 4-(benzimidazol-1-ylmethyl)-2-thiophen-2-yl-1,3-oxazole.
| Compound Name | 4-(benzimidazol-1-ylmethyl)-2-thiophen-2-yl-1,3-oxazole |
|---|---|
| PubChem CID | 17404827 |
| Molecular Formula | C15H11N3OS |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 4-(benzimidazol-1-ylmethyl)-2-thiophen-2-yl-1,3-oxazole |
| SMILES | c1csc(-c2nc(Cn3cnc4ccccc43)co2)c1 |
| InChI | InChI=1S/C15H11N3OS/c1-2-5-13-12(4-1)16-10-18(13)8-11-9-19-15(17-11)14-6-3-7-20-14/h1-7,9-10H,8H2 |
| InChIKey | WGEYMZIHKMVSPC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |