C32H60O10 — CID 174049403
ethyl 2-[2-[3,4-bis(2-hydroxyethoxy)oxolan-2-yl]-2-(2-hydroxyethoxy)ethoxy]octadec-9-enoate (PubChem CID 174049403) has the molecular formula C32H60O10 and a molecular weight of 604.82 g/mol. Its IUPAC name is ethyl 2-[2-[3,4-bis(2-hydroxyethoxy)oxolan-2-yl]-2-(2-hydroxyethoxy)ethoxy]octadec-9-enoate.
| Compound Name | ethyl 2-[2-[3,4-bis(2-hydroxyethoxy)oxolan-2-yl]-2-(2-hydroxyethoxy)ethoxy]octadec-9-enoate |
|---|---|
| PubChem CID | 174049403 |
| Molecular Formula | C32H60O10 |
| Molecular Weight | 604.82 g/mol |
| Exact Mass | 604.42 |
| IUPAC Name | ethyl 2-[2-[3,4-bis(2-hydroxyethoxy)oxolan-2-yl]-2-(2-hydroxyethoxy)ethoxy]octadec-9-enoate |
| SMILES | CCCCCCCCC=CCCCCCCC(OCC(OCCO)C1OCC(OCCO)C1OCCO)C(=O)OCC |
| InChI | InChI=1S/C32H60O10/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-27(32(36)37-4-2)41-25-28(38-22-19-33)31-30(40-24-21-35)29(26-42-31)39-23-20-34/h11-12,27-31,33-35H,3-10,13-26H2,1-2H3 |
| InChIKey | IXSWCIAOLWNFDO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 133.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.82 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|