C39H74O12 — CID 90307111
[2-[3,4-bis[2-(2-hydroxyethoxy)propoxy]oxolan-2-yl]-2-[2-(2-hydroxyethoxy)propoxy]ethyl] (Z)-octadec-9-enoate (PubChem CID 90307111) has the molecular formula C39H74O12 and a molecular weight of 735.01 g/mol. Its IUPAC name is [2-[3,4-bis[2-(2-hydroxyethoxy)propoxy]oxolan-2-yl]-2-[2-(2-hydroxyethoxy)propoxy]ethyl] (Z)-octadec-9-enoate.
| Compound Name | [2-[3,4-bis[2-(2-hydroxyethoxy)propoxy]oxolan-2-yl]-2-[2-(2-hydroxyethoxy)propoxy]ethyl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 90307111 |
| Molecular Formula | C39H74O12 |
| Molecular Weight | 735.01 g/mol |
| Exact Mass | 734.52 |
| IUPAC Name | [2-[3,4-bis[2-(2-hydroxyethoxy)propoxy]oxolan-2-yl]-2-[2-(2-hydroxyethoxy)propoxy]ethyl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(OCC(C)OCCO)C1OCC(OCC(C)OCCO)C1OCC(C)OCCO |
| InChI | InChI=1S/C39H74O12/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-37(43)49-30-35(47-27-32(2)44-24-21-40)39-38(50-29-34(4)46-26-23-42)36(31-51-39)48-28-33(3)45-25-22-41/h12-13,32-36,38-42H,5-11,14-31H2,1-4H3/b13-12- |
| InChIKey | SUHSPHSQFOBZPE-SEYXRHQNSA-N |
| XLogP | 5.31 |
| TPSA | 151.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.01 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|