C11F24OSi — CID 174051782
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-henicosafluoro-1-trifluorosilylundecan-1-one (PubChem CID 174051782) has the molecular formula C11F24OSi and a molecular weight of 632.16 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-henicosafluoro-1-trifluorosilylundecan-1-one.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-henicosafluoro-1-trifluorosilylundecan-1-one |
|---|---|
| PubChem CID | 174051782 |
| Molecular Formula | C11F24OSi |
| Molecular Weight | 632.16 g/mol |
| Exact Mass | 631.93 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-henicosafluoro-1-trifluorosilylundecan-1-one |
| SMILES | O=C(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)[Si](F)(F)F |
| InChI | InChI=1S/C11F24OSi/c12-2(13,1(36)37(33,34)35)3(14,15)4(16,17)5(18,19)6(20,21)7(22,23)8(24,25)9(26,27)10(28,29)11(30,31)32 |
| InChIKey | GWODQOPYKUHHPE-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.16 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|