C48H41B2N3OS3 — CID 174069111
CID 174069111 (PubChem CID 174069111) has the molecular formula C48H41B2N3OS3 and a molecular weight of 793.70 g/mol.
| Compound Name | CID 174069111 |
|---|---|
| PubChem CID | 174069111 |
| Molecular Formula | C48H41B2N3OS3 |
| Molecular Weight | 793.70 g/mol |
| Exact Mass | 793.26 |
| IUPAC Name | — |
| SMILES | [B]S(C)(C)C1(S([B])(C)C)c2ccccc2Oc2c1cccc2S(c1ccccc1)(c1ccccc1)c1cccc(-n2c3ccccc3n3c4ccccc4nc23)c1 |
| InChI | InChI=1S/C48H41B2N3OS3/c1-55(2,49)48(56(3,4)50)38-25-11-16-31-44(38)54-46-39(48)26-18-32-45(46)57(35-20-7-5-8-21-35,36-22-9-6-10-23-36)37-24-17-19-34(33-37)52-42-29-14-15-30-43(42)53-41-28-13-12-27-40(41)51-47(52)53/h5-33H,1-4H3 |
| InChIKey | IVHVVKFZMGFVKT-UHFFFAOYSA-N |
| XLogP | 12.37 |
| TPSA | 31.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.70 |
| LogP ≤ 5 | 12.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|